C11F5O5Re- — CID 631925
carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium (PubChem CID 631925) has the molecular formula C11F5O5Re- and a molecular weight of 493.31 g/mol. Its IUPAC name is carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium.
| Compound Name | carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium |
|---|---|
| PubChem CID | 631925 |
| Molecular Formula | C11F5O5Re- |
| Molecular Weight | 493.31 g/mol |
| Exact Mass | 493.92 |
| IUPAC Name | carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium |
| SMILES | Fc1[c-]c(F)c(F)c(F)c1F.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re] |
| InChI | InChI=1S/C6F5.5CO.Re/c7-2-1-3(8)5(10)6(11)4(2)9;5*1-2;/q-1;;;;;; |
| InChIKey | KKBJXNSEMFNPSC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|