carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium

C11F5O5Re- — CID 631925

IUPACcarbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium
SMILESFc1[c-]c(F)c(F)c(F)c1F.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re]
InChIInChI=1S/C6F5.5CO.Re/c7-2-1-3(8)5(10)6(11)4(2)9;5*1-2;/q-1;;;;;;
InChIKeyKKBJXNSEMFNPSC-UHFFFAOYSA-N
MW493.31 g/mol
LogP1.99
Rot. Bonds

About carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium

carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium (PubChem CID 631925) has the molecular formula C11F5O5Re- and a molecular weight of 493.31 g/mol. Its IUPAC name is carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium.

Molecular Properties

Compound Namecarbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium
PubChem CID631925
Molecular FormulaC11F5O5Re-
Molecular Weight493.31 g/mol
Exact Mass493.92
IUPAC Namecarbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium
SMILESFc1[c-]c(F)c(F)c(F)c1F.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re]
InChIInChI=1S/C6F5.5CO.Re/c7-2-1-3(8)5(10)6(11)4(2)9;5*1-2;/q-1;;;;;;
InChIKeyKKBJXNSEMFNPSC-UHFFFAOYSA-N
XLogP1.99
TPSA99.50 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500493.31
LogP ≤ 51.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium?
The IUPAC name of carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium (CID 631925) is carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium.
What is the SMILES notation for carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium?
The canonical SMILES for carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium is Fc1[c-]c(F)c(F)c(F)c1F.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[Re].
What is the InChIKey of carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium?
The InChIKey is KKBJXNSEMFNPSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6F5.5CO.Re/c7-2-1-3(8)5(10)6(11)4(2)9;5*1-2;/q-1;;;;;;.
What are the key properties of carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium?
carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium has a molecular weight of 493.31 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;1,2,3,4,5-pentafluorobenzene-6-ide;rhenium is sourced from PubChem (CID 631925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).