C6F4Li2 — CID 165346414
dilithium;1,2,4,5-tetrafluorobenzene-3,6-diide (PubChem CID 165346414) has the molecular formula C6F4Li2 and a molecular weight of 161.94 g/mol. Its IUPAC name is dilithium;1,2,4,5-tetrafluorobenzene-3,6-diide.
| Compound Name | dilithium;1,2,4,5-tetrafluorobenzene-3,6-diide |
|---|---|
| PubChem CID | 165346414 |
| Molecular Formula | C6F4Li2 |
| Molecular Weight | 161.94 g/mol |
| Exact Mass | 162.03 |
| IUPAC Name | dilithium;1,2,4,5-tetrafluorobenzene-3,6-diide |
| SMILES | Fc1[c-]c(F)c(F)[c-]c1F.[Li+].[Li+] |
| InChI | InChI=1S/C6F4.2Li/c7-3-1-4(8)6(10)2-5(3)9;;/q-2;2*+1 |
| InChIKey | OKYBDZRMGAUJPI-UHFFFAOYSA-N |
| XLogP | -4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.94 |
| LogP ≤ 5 | -4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|