C19H11CuF4N2O — CID 87647798
copper(1+);1,10-phenanthroline;1,2,4,5-tetrafluoro-3-methoxybenzene-6-ide (PubChem CID 87647798) has the molecular formula C19H11CuF4N2O and a molecular weight of 422.85 g/mol. Its IUPAC name is copper(1+);1,10-phenanthroline;1,2,4,5-tetrafluoro-3-methoxybenzene-6-ide.
| Compound Name | copper(1+);1,10-phenanthroline;1,2,4,5-tetrafluoro-3-methoxybenzene-6-ide |
|---|---|
| PubChem CID | 87647798 |
| Molecular Formula | C19H11CuF4N2O |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | copper(1+);1,10-phenanthroline;1,2,4,5-tetrafluoro-3-methoxybenzene-6-ide |
| SMILES | COc1c(F)c(F)[c-]c(F)c1F.[Cu+].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C7H3F4O.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-12-7-5(10)3(8)2-4(9)6(7)11;/h1-8H;1H3;/q;-1;+1 |
| InChIKey | UITGVIBBDPTNJD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|