About tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate
tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate (PubChem CID 21338895) has the molecular formula C20H26N2O5
and a molecular weight of 374.44 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate |
| PubChem CID | 21338895 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate |
| SMILES | CCOc1c(Nc2ccc(CC(C)NC(=O)OC(C)(C)C)cc2)c(=O)c1=O |
| InChI | InChI=1S/C20H26N2O5/c1-6-26-18-15(16(23)17(18)24)22-14-9-7-13(8-10-14)11-12(2)21-19(25)27-20(3,4)5/h7-10,12,22H,6,11H2,1-5H3,(H,21,25) |
| InChIKey | MHVWKWVQYINTBF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate (CID 21338895) is tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate is CCOc1c(Nc2ccc(CC(C)NC(=O)OC(C)(C)C)cc2)c(=O)c1=O.
What is the InChIKey of tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate?
The InChIKey is MHVWKWVQYINTBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O5/c1-6-26-18-15(16(23)17(18)24)22-14-9-7-13(8-10-14)11-12(2)21-19(25)27-20(3,4)5/h7-10,12,22H,6,11H2,1-5H3,(H,21,25).
What are the key properties of tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate?
tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate has a molecular weight of 374.44 g/mol, XLogP of 2.88, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[1-[4-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]phenyl]propan-2-yl]carbamate is sourced from PubChem (CID 21338895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).