C13H24O2S — CID 21339754
7-ethyl-1-ethylsulfanylnonane-2,8-dione (PubChem CID 21339754) has the molecular formula C13H24O2S and a molecular weight of 244.40 g/mol. Its IUPAC name is 7-ethyl-1-ethylsulfanylnonane-2,8-dione.
| Compound Name | 7-ethyl-1-ethylsulfanylnonane-2,8-dione |
|---|---|
| PubChem CID | 21339754 |
| Molecular Formula | C13H24O2S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 7-ethyl-1-ethylsulfanylnonane-2,8-dione |
| SMILES | CCSCC(=O)CCCCC(CC)C(C)=O |
| InChI | InChI=1S/C13H24O2S/c1-4-12(11(3)14)8-6-7-9-13(15)10-16-5-2/h12H,4-10H2,1-3H3 |
| InChIKey | WUJREDSODPSUGQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|