C35H42N6O4S — CID 21340147
(2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-pyrrolidin-1-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 21340147) has the molecular formula C35H42N6O4S and a molecular weight of 642.83 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-pyrrolidin-1-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-pyrrolidin-1-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 21340147 |
| Molecular Formula | C35H42N6O4S |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[3-[(2-ethyl-5-methylphenoxy)sulfinylamino]-4-pyrrolidin-1-ylphenyl]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(N4CCCC4)c(NS(=O)Oc4cc(C)ccc4CC)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C35H42N6O4S/c1-7-25-11-10-21(2)18-30(25)45-46(43)39-27-19-26(12-13-29(27)40-14-8-9-15-40)33-37-34-31(28(36-6)20-41(34)38-33)35(42)44-32-23(4)16-22(3)17-24(32)5/h10-13,18-20,22-24,32,39H,7-9,14-17H2,1-5H3,(H,37,38) |
| InChIKey | FHWSEAZPEZKWRI-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|