C35H41N5O5 — CID 54412745
4-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]pentanoic acid (PubChem CID 54412745) has the molecular formula C35H41N5O5 and a molecular weight of 611.74 g/mol. Its IUPAC name is 4-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]pentanoic acid.
| Compound Name | 4-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]pentanoic acid |
|---|---|
| PubChem CID | 54412745 |
| Molecular Formula | C35H41N5O5 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | 4-[2-[5-[6-isocyano-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-2-yl]-2-methylanilino]-4-methylphenoxy]pentanoic acid |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(C)c(Nc4cc(C)ccc4OC(C)CCC(=O)O)c3)nc2c1C(=O)OC1C(C)CC(C)CC1C |
| InChI | InChI=1S/C35H41N5O5/c1-19-8-12-29(44-24(6)10-13-30(41)42)27(16-19)37-26-17-25(11-9-21(26)3)33-38-34-31(28(36-7)18-40(34)39-33)35(43)45-32-22(4)14-20(2)15-23(32)5/h8-9,11-12,16-18,20,22-24,32,37H,10,13-15H2,1-6H3,(H,38,39)(H,41,42) |
| InChIKey | BSWNVMRPWOFXGT-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|