C40H59N5O3 — CID 20751779
(2,4,6-trimethylcyclohexyl) 5-(dioctylcarbamoyl)-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20751779) has the molecular formula C40H59N5O3 and a molecular weight of 657.94 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-(dioctylcarbamoyl)-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-(dioctylcarbamoyl)-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20751779 |
| Molecular Formula | C40H59N5O3 |
| Molecular Weight | 657.94 g/mol |
| Exact Mass | 657.46 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-(dioctylcarbamoyl)-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(C)cc3)[nH]n2c1C(=O)N(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C40H59N5O3/c1-8-10-12-14-16-18-24-44(25-19-17-15-13-11-9-2)39(46)35-34(41-7)33(40(47)48-36-30(5)26-29(4)27-31(36)6)38-42-37(43-45(35)38)32-22-20-28(3)21-23-32/h20-23,29-31,36H,8-19,24-27H2,1-6H3,(H,42,43) |
| InChIKey | XTBGWCVWSKIYPD-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.94 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|