C31H37N5O3 — CID 20751827
(4-ethyl-2,6-dimethylcyclohexyl) 5-[bis(prop-2-enyl)carbamoyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20751827) has the molecular formula C31H37N5O3 and a molecular weight of 527.67 g/mol. Its IUPAC name is (4-ethyl-2,6-dimethylcyclohexyl) 5-[bis(prop-2-enyl)carbamoyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (4-ethyl-2,6-dimethylcyclohexyl) 5-[bis(prop-2-enyl)carbamoyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20751827 |
| Molecular Formula | C31H37N5O3 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.29 |
| IUPAC Name | (4-ethyl-2,6-dimethylcyclohexyl) 5-[bis(prop-2-enyl)carbamoyl]-6-isocyano-2-(4-methylphenyl)-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(CC)CC2C)c2nc(-c3ccc(C)cc3)[nH]n2c1C(=O)N(CC=C)CC=C |
| InChI | InChI=1S/C31H37N5O3/c1-8-15-35(16-9-2)30(37)26-25(32-7)24(31(38)39-27-20(5)17-22(10-3)18-21(27)6)29-33-28(34-36(26)29)23-13-11-19(4)12-14-23/h8-9,11-14,20-22,27H,1-2,10,15-18H2,3-6H3,(H,33,34) |
| InChIKey | UBIFKGBMRXFDGH-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|