C41H56N6O6 — CID 20603049
(2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-acetamido-4-[(2-methylpropan-2-yl)oxy]phenyl]-5-[bis(prop-2-enyl)carbamoyloxy]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20603049) has the molecular formula C41H56N6O6 and a molecular weight of 728.93 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-acetamido-4-[(2-methylpropan-2-yl)oxy]phenyl]-5-[bis(prop-2-enyl)carbamoyloxy]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-acetamido-4-[(2-methylpropan-2-yl)oxy]phenyl]-5-[bis(prop-2-enyl)carbamoyloxy]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20603049 |
| Molecular Formula | C41H56N6O6 |
| Molecular Weight | 728.93 g/mol |
| Exact Mass | 728.43 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 2-[3-acetamido-4-[(2-methylpropan-2-yl)oxy]phenyl]-5-[bis(prop-2-enyl)carbamoyloxy]-6-isocyano-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C(C)(C)C)CC(C)CC2C(C)(C)C)c2nc(-c3ccc(OC(C)(C)C)c(NC(C)=O)c3)[nH]n2c1OC(=O)N(CC=C)CC=C |
| InChI | InChI=1S/C41H56N6O6/c1-15-19-46(20-16-2)38(50)52-36-32(42-14)31(37(49)51-33-27(39(5,6)7)21-24(3)22-28(33)40(8,9)10)35-44-34(45-47(35)36)26-17-18-30(53-41(11,12)13)29(23-26)43-25(4)48/h15-18,23-24,27-28,33H,1-2,19-22H2,3-13H3,(H,43,48)(H,44,45) |
| InChIKey | SPKHEPRYNNXGCU-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.93 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|