C30H36N8O6S — CID 54387197
(2,4,6-trimethylcyclohexyl) 5-[(cyclopropylideneamino)-[(Z)-propylideneamino]carbamoyl]oxy-6-isocyano-2-[3-(methanesulfonamido)phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 54387197) has the molecular formula C30H36N8O6S and a molecular weight of 636.74 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 5-[(cyclopropylideneamino)-[(Z)-propylideneamino]carbamoyl]oxy-6-isocyano-2-[3-(methanesulfonamido)phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 5-[(cyclopropylideneamino)-[(Z)-propylideneamino]carbamoyl]oxy-6-isocyano-2-[3-(methanesulfonamido)phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 54387197 |
| Molecular Formula | C30H36N8O6S |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 5-[(cyclopropylideneamino)-[(Z)-propylideneamino]carbamoyl]oxy-6-isocyano-2-[3-(methanesulfonamido)phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3cccc(NS(C)(=O)=O)c3)[nH]n2c1OC(=O)N(N=C1CC1)/N=C\CC |
| InChI | InChI=1S/C30H36N8O6S/c1-7-13-32-38(34-21-11-12-21)30(40)44-28-24(31-5)23(29(39)43-25-18(3)14-17(2)15-19(25)4)27-33-26(35-37(27)28)20-9-8-10-22(16-20)36-45(6,41)42/h8-10,13,16-19,25,36H,7,11-12,14-15H2,1-4,6H3,(H,33,35)/b32-13- |
| InChIKey | SJTOWMHKVXMVTG-VKVKMMGJSA-N |
| XLogP | 5.83 |
| TPSA | 164.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|