C51H75N5O5S — CID 20580406
(2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[(2-octoxy-5-octylphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate (PubChem CID 20580406) has the molecular formula C51H75N5O5S and a molecular weight of 870.26 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[(2-octoxy-5-octylphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[(2-octoxy-5-octylphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
|---|---|
| PubChem CID | 20580406 |
| Molecular Formula | C51H75N5O5S |
| Molecular Weight | 870.26 g/mol |
| Exact Mass | 869.55 |
| IUPAC Name | (2,6-ditert-butyl-4-methylcyclohexyl) 6-isocyano-2-[4-methyl-3-[(2-octoxy-5-octylphenoxy)sulfinylamino]phenyl]-3H-pyrrolo[1,2-b][1,2,4]triazole-7-carboxylate |
| SMILES | [C-]#[N+]c1cn2[nH]c(-c3ccc(C)c(NS(=O)Oc4cc(CCCCCCCC)ccc4OCCCCCCCC)c3)nc2c1C(=O)OC1C(C(C)(C)C)CC(C)CC1C(C)(C)C |
| InChI | InChI=1S/C51H75N5O5S/c1-12-14-16-18-20-22-24-37-26-28-43(59-29-23-21-19-17-15-13-2)44(32-37)61-62(58)55-41-33-38(27-25-36(41)4)47-53-48-45(42(52-11)34-56(48)54-47)49(57)60-46-39(50(5,6)7)30-35(3)31-40(46)51(8,9)10/h25-28,32-35,39-40,46,55H,12-24,29-31H2,1-10H3,(H,53,54) |
| InChIKey | MUCWNNYNELUOLK-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.26 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|