C35H50N4O6S — CID 18739463
(2,4,6-trimethylcyclohexyl) 2-[3-[4-methoxy-3-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 18739463) has the molecular formula C35H50N4O6S and a molecular weight of 654.87 g/mol. Its IUPAC name is (2,4,6-trimethylcyclohexyl) 2-[3-[4-methoxy-3-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-1H-1,2,4-triazol-5-yl]acetate.
| Compound Name | (2,4,6-trimethylcyclohexyl) 2-[3-[4-methoxy-3-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-1H-1,2,4-triazol-5-yl]acetate |
|---|---|
| PubChem CID | 18739463 |
| Molecular Formula | C35H50N4O6S |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | (2,4,6-trimethylcyclohexyl) 2-[3-[4-methoxy-3-[(5-methyl-2-octoxyphenoxy)sulfinylamino]phenyl]-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | CCCCCCCCOc1ccc(C)cc1OS(=O)Nc1cc(-c2n[nH]c(CC(=O)OC3C(C)CC(C)CC3C)n2)ccc1OC |
| InChI | InChI=1S/C35H50N4O6S/c1-7-8-9-10-11-12-17-43-30-15-13-23(2)20-31(30)45-46(41)39-28-21-27(14-16-29(28)42-6)35-36-32(37-38-35)22-33(40)44-34-25(4)18-24(3)19-26(34)5/h13-16,20-21,24-26,34,39H,7-12,17-19,22H2,1-6H3,(H,36,37,38) |
| InChIKey | JSRRSKYFXICFTA-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 124.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|