C40H56N4O4S — CID 59085290
6-(2,2-dimethylpropanoyl)-5-isocyano-2-[4-[(2-octoxy-4-octylphenoxy)sulfinylamino]phenyl]-1,3a,6,6a-tetrahydrocyclopenta[d]imidazole (PubChem CID 59085290) has the molecular formula C40H56N4O4S and a molecular weight of 688.98 g/mol. Its IUPAC name is 6-(2,2-dimethylpropanoyl)-5-isocyano-2-[4-[(2-octoxy-4-octylphenoxy)sulfinylamino]phenyl]-1,3a,6,6a-tetrahydrocyclopenta[d]imidazole.
| Compound Name | 6-(2,2-dimethylpropanoyl)-5-isocyano-2-[4-[(2-octoxy-4-octylphenoxy)sulfinylamino]phenyl]-1,3a,6,6a-tetrahydrocyclopenta[d]imidazole |
|---|---|
| PubChem CID | 59085290 |
| Molecular Formula | C40H56N4O4S |
| Molecular Weight | 688.98 g/mol |
| Exact Mass | 688.40 |
| IUPAC Name | 6-(2,2-dimethylpropanoyl)-5-isocyano-2-[4-[(2-octoxy-4-octylphenoxy)sulfinylamino]phenyl]-1,3a,6,6a-tetrahydrocyclopenta[d]imidazole |
| SMILES | [C-]#[N+]C1=CC2N=C(c3ccc(NS(=O)Oc4ccc(CCCCCCCC)cc4OCCCCCCCC)cc3)NC2C1C(=O)C(C)(C)C |
| InChI | InChI=1S/C40H56N4O4S/c1-7-9-11-13-15-17-19-29-20-25-34(35(27-29)47-26-18-16-14-12-10-8-2)48-49(46)44-31-23-21-30(22-24-31)39-42-33-28-32(41-6)36(37(33)43-39)38(45)40(3,4)5/h20-25,27-28,33,36-37,44H,7-19,26H2,1-5H3,(H,42,43) |
| InChIKey | UZEVCYPCZDXFSM-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.98 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|