C15H26O2 — CID 21340947
3,3-dimethyl-1-[4-(2-oxopropyl)cyclohexyl]butan-2-one (PubChem CID 21340947) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-(2-oxopropyl)cyclohexyl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[4-(2-oxopropyl)cyclohexyl]butan-2-one |
|---|---|
| PubChem CID | 21340947 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | 3,3-dimethyl-1-[4-(2-oxopropyl)cyclohexyl]butan-2-one |
| SMILES | CC(=O)CC1CCC(CC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H26O2/c1-11(16)9-12-5-7-13(8-6-12)10-14(17)15(2,3)4/h12-13H,5-10H2,1-4H3 |
| InChIKey | XEBNRXJUGFDXLG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |