C11H20O3 — CID 174392366
1-[4-(1,1-dihydroxyethyl)cyclohexyl]propan-2-one (PubChem CID 174392366) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-[4-(1,1-dihydroxyethyl)cyclohexyl]propan-2-one.
| Compound Name | 1-[4-(1,1-dihydroxyethyl)cyclohexyl]propan-2-one |
|---|---|
| PubChem CID | 174392366 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1-[4-(1,1-dihydroxyethyl)cyclohexyl]propan-2-one |
| SMILES | CC(=O)CC1CCC(C(C)(O)O)CC1 |
| InChI | InChI=1S/C11H20O3/c1-8(12)7-9-3-5-10(6-4-9)11(2,13)14/h9-10,13-14H,3-7H2,1-2H3 |
| InChIKey | OGAOMYIQGVXIHC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|