About 1-cyclopentylpropan-2-one;thiophene
1-cyclopentylpropan-2-one;thiophene (PubChem CID 174397115) has the molecular formula C12H18OS
and a molecular weight of 210.34 g/mol. Its IUPAC name is 1-cyclopentylpropan-2-one;thiophene.
Molecular Properties
| Compound Name | 1-cyclopentylpropan-2-one;thiophene |
| PubChem CID | 174397115 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-cyclopentylpropan-2-one;thiophene |
| SMILES | CC(=O)CC1CCCC1.c1ccsc1 |
| InChI | InChI=1S/C8H14O.C4H4S/c1-7(9)6-8-4-2-3-5-8;1-2-4-5-3-1/h8H,2-6H2,1H3;1-4H |
| InChIKey | WSSBFNPLCJAOJX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentylpropan-2-one;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylpropan-2-one;thiophene?
The IUPAC name of 1-cyclopentylpropan-2-one;thiophene (CID 174397115) is 1-cyclopentylpropan-2-one;thiophene.
What is the SMILES notation for 1-cyclopentylpropan-2-one;thiophene?
The canonical SMILES for 1-cyclopentylpropan-2-one;thiophene is CC(=O)CC1CCCC1.c1ccsc1.
What is the InChIKey of 1-cyclopentylpropan-2-one;thiophene?
The InChIKey is WSSBFNPLCJAOJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.C4H4S/c1-7(9)6-8-4-2-3-5-8;1-2-4-5-3-1/h8H,2-6H2,1H3;1-4H.
What are the key properties of 1-cyclopentylpropan-2-one;thiophene?
1-cyclopentylpropan-2-one;thiophene has a molecular weight of 210.34 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylpropan-2-one;thiophene is sourced from PubChem (CID 174397115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).