About 1-[ethyl(methyl)amino]-1,2-dimethylguanidine
1-[ethyl(methyl)amino]-1,2-dimethylguanidine (PubChem CID 21341304) has the molecular formula C6H16N4
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-[ethyl(methyl)amino]-1,2-dimethylguanidine.
Molecular Properties
| Compound Name | 1-[ethyl(methyl)amino]-1,2-dimethylguanidine |
| PubChem CID | 21341304 |
| Molecular Formula | C6H16N4 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.14 |
| IUPAC Name | 1-[ethyl(methyl)amino]-1,2-dimethylguanidine |
| SMILES | CCN(C)N(C)/C(N)=N/C |
| InChI | InChI=1S/C6H16N4/c1-5-9(3)10(4)6(7)8-2/h5H2,1-4H3,(H2,7,8) |
| InChIKey | RKUXFOIEYIYEGT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[ethyl(methyl)amino]-1,2-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[ethyl(methyl)amino]-1,2-dimethylguanidine?
The IUPAC name of 1-[ethyl(methyl)amino]-1,2-dimethylguanidine (CID 21341304) is 1-[ethyl(methyl)amino]-1,2-dimethylguanidine.
What is the SMILES notation for 1-[ethyl(methyl)amino]-1,2-dimethylguanidine?
The canonical SMILES for 1-[ethyl(methyl)amino]-1,2-dimethylguanidine is CCN(C)N(C)/C(N)=N/C.
What is the InChIKey of 1-[ethyl(methyl)amino]-1,2-dimethylguanidine?
The InChIKey is RKUXFOIEYIYEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N4/c1-5-9(3)10(4)6(7)8-2/h5H2,1-4H3,(H2,7,8).
What are the key properties of 1-[ethyl(methyl)amino]-1,2-dimethylguanidine?
1-[ethyl(methyl)amino]-1,2-dimethylguanidine has a molecular weight of 144.22 g/mol, XLogP of -0.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[ethyl(methyl)amino]-1,2-dimethylguanidine is sourced from PubChem (CID 21341304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).