C5H14N4 — CID 174270075
1-amino-1,2-diethylguanidine (PubChem CID 174270075) has the molecular formula C5H14N4 and a molecular weight of 130.19 g/mol. Its IUPAC name is 1-amino-1,2-diethylguanidine.
| Compound Name | 1-amino-1,2-diethylguanidine |
|---|---|
| PubChem CID | 174270075 |
| Molecular Formula | C5H14N4 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | 1-amino-1,2-diethylguanidine |
| SMILES | CC/N=C(\N)N(N)CC |
| InChI | InChI=1S/C5H14N4/c1-3-8-5(6)9(7)4-2/h3-4,7H2,1-2H3,(H2,6,8) |
| InChIKey | DRXALRXZQKJADX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|