C6H14N6 — CID 21081841
2-propyl-2H-1,3,5-triazine-1,4,6-triamine (PubChem CID 21081841) has the molecular formula C6H14N6 and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-propyl-2H-1,3,5-triazine-1,4,6-triamine.
| Compound Name | 2-propyl-2H-1,3,5-triazine-1,4,6-triamine |
|---|---|
| PubChem CID | 21081841 |
| Molecular Formula | C6H14N6 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 2-propyl-2H-1,3,5-triazine-1,4,6-triamine |
| SMILES | CCCC1N=C(N)N=C(N)N1N |
| InChI | InChI=1S/C6H14N6/c1-2-3-4-10-5(7)11-6(8)12(4)9/h4H,2-3,9H2,1H3,(H4,7,8,10,11) |
| InChIKey | OSUYQFYCMODCGN-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|