C4H14N6 — CID 155737101
1,2,3-triamino-1-propylguanidine (PubChem CID 155737101) has the molecular formula C4H14N6 and a molecular weight of 146.20 g/mol. Its IUPAC name is 1,2,3-triamino-1-propylguanidine.
| Compound Name | 1,2,3-triamino-1-propylguanidine |
|---|---|
| PubChem CID | 155737101 |
| Molecular Formula | C4H14N6 |
| Molecular Weight | 146.20 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | 1,2,3-triamino-1-propylguanidine |
| SMILES | CCCN(N)/C(=N/N)NN |
| InChI | InChI=1S/C4H14N6/c1-2-3-10(7)4(8-5)9-6/h2-3,5-7H2,1H3,(H,8,9) |
| InChIKey | IEPYODPXWPITLU-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.20 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|