C4H14N8 — CID 57211337
1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine (PubChem CID 57211337) has the molecular formula C4H14N8 and a molecular weight of 174.21 g/mol. Its IUPAC name is 1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine.
| Compound Name | 1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine |
|---|---|
| PubChem CID | 57211337 |
| Molecular Formula | C4H14N8 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine |
| SMILES | NN=C(N)N(N)CCN=C(N)N |
| InChI | InChI=1S/C4H14N8/c5-3(6)10-1-2-12(9)4(7)11-8/h1-2,8-9H2,(H2,7,11)(H4,5,6,10) |
| InChIKey | PTRWRZBXQSHWBO-UHFFFAOYSA-N |
| XLogP | -3.38 |
| TPSA | 158.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|