C4H16Cl2N8 — CID 173440206
1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine;dihydrochloride (PubChem CID 173440206) has the molecular formula C4H16Cl2N8 and a molecular weight of 247.13 g/mol. Its IUPAC name is 1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine;dihydrochloride.
| Compound Name | 1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 173440206 |
| Molecular Formula | C4H16Cl2N8 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1,2-diamino-1-[2-(diaminomethylideneamino)ethyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NN=C(N)N(N)CCN=C(N)N |
| InChI | InChI=1S/C4H14N8.2ClH/c5-3(6)10-1-2-12(9)4(7)11-8;;/h1-2,8-9H2,(H2,7,11)(H4,5,6,10);2*1H |
| InChIKey | XDIBYIALEXKMRQ-UHFFFAOYSA-N |
| XLogP | -2.53 |
| TPSA | 158.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|