C3H10Cl2N4 — CID 141013157
4,5-dihydroimidazole-1,2-diamine;dihydrochloride (PubChem CID 141013157) has the molecular formula C3H10Cl2N4 and a molecular weight of 173.05 g/mol. Its IUPAC name is 4,5-dihydroimidazole-1,2-diamine;dihydrochloride.
| Compound Name | 4,5-dihydroimidazole-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 141013157 |
| Molecular Formula | C3H10Cl2N4 |
| Molecular Weight | 173.05 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 4,5-dihydroimidazole-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1=NCCN1N |
| InChI | InChI=1S/C3H8N4.2ClH/c4-3-6-1-2-7(3)5;;/h1-2,5H2,(H2,4,6);2*1H |
| InChIKey | IRFKRJKLIWTTEH-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.05 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|