C6H17N7 — CID 144561900
1-amino-3-(diaminomethylidene)-1-[2-(dimethylamino)ethyl]guanidine (PubChem CID 144561900) has the molecular formula C6H17N7 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-amino-3-(diaminomethylidene)-1-[2-(dimethylamino)ethyl]guanidine.
| Compound Name | 1-amino-3-(diaminomethylidene)-1-[2-(dimethylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 144561900 |
| Molecular Formula | C6H17N7 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.15 |
| IUPAC Name | 1-amino-3-(diaminomethylidene)-1-[2-(dimethylamino)ethyl]guanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(N)CCN(C)C |
| InChI | InChI=1S/C6H17N7/c1-12(2)3-4-13(10)6(9)11-5(7)8/h3-4,10H2,1-2H3,(H5,7,8,9,11) |
| InChIKey | JOXCMIUABIZNQP-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|