C18H31N2+ — CID 21342162
1,3-dicyclohexyl-4,6-dimethyl-2H-pyrimidin-3-ium (PubChem CID 21342162) has the molecular formula C18H31N2+ and a molecular weight of 275.46 g/mol. Its IUPAC name is 1,3-dicyclohexyl-4,6-dimethyl-2H-pyrimidin-3-ium.
| Compound Name | 1,3-dicyclohexyl-4,6-dimethyl-2H-pyrimidin-3-ium |
|---|---|
| PubChem CID | 21342162 |
| Molecular Formula | C18H31N2+ |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.25 |
| IUPAC Name | 1,3-dicyclohexyl-4,6-dimethyl-2H-pyrimidin-3-ium |
| SMILES | CC1=CC(C)=[N+](C2CCCCC2)CN1C1CCCCC1 |
| InChI | InChI=1S/C18H31N2/c1-15-13-16(2)20(18-11-7-4-8-12-18)14-19(15)17-9-5-3-6-10-17/h13,17-18H,3-12,14H2,1-2H3/q+1 |
| InChIKey | DDKYJPRUBNXAJG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|