About cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium
cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium (PubChem CID 23578228) has the molecular formula C17H29Cl2N2Ti-
and a molecular weight of 380.21 g/mol. Its IUPAC name is cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium.
Molecular Properties
| Compound Name | cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium |
| PubChem CID | 23578228 |
| Molecular Formula | C17H29Cl2N2Ti- |
| Molecular Weight | 380.21 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium |
| SMILES | C/C(=C/C(C)=N/C1CCCCC1)[N-]C1CCCCC1.Cl[Ti]Cl |
| InChI | InChI=1S/C17H29N2.2ClH.Ti/c1-14(18-16-9-5-3-6-10-16)13-15(2)19-17-11-7-4-8-12-17;;;/h13,16-17H,3-12H2,1-2H3;2*1H;/q-1;;;+2/p-2/b14-13-,19-15+;;; |
| InChIKey | ZBNGCANIQPEPRN-CKYCSHMFSA-L |
| XLogP | 6.77 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.21 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium?
The IUPAC name of cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium (CID 23578228) is cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium.
What is the SMILES notation for cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium?
The canonical SMILES for cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium is C/C(=C/C(C)=N/C1CCCCC1)[N-]C1CCCCC1.Cl[Ti]Cl.
What is the InChIKey of cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium?
The InChIKey is ZBNGCANIQPEPRN-CKYCSHMFSA-L. The full InChI is InChI=1S/C17H29N2.2ClH.Ti/c1-14(18-16-9-5-3-6-10-16)13-15(2)19-17-11-7-4-8-12-17;;;/h13,16-17H,3-12H2,1-2H3;2*1H;/q-1;;;+2/p-2/b14-13-,19-15+;;;.
What are the key properties of cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium?
cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium has a molecular weight of 380.21 g/mol, XLogP of 6.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[(Z)-4-cyclohexyliminopent-2-en-2-yl]azanide;dichlorotitanium is sourced from PubChem (CID 23578228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).