C17H30N2 — CID 15055248
N-[(E)-4-cyclohexyliminopent-2-en-2-yl]cyclohexanamine (PubChem CID 15055248) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N-[(E)-4-cyclohexyliminopent-2-en-2-yl]cyclohexanamine.
| Compound Name | N-[(E)-4-cyclohexyliminopent-2-en-2-yl]cyclohexanamine |
|---|---|
| PubChem CID | 15055248 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N-[(E)-4-cyclohexyliminopent-2-en-2-yl]cyclohexanamine |
| SMILES | C/C(=C\C(C)=N\C1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C17H30N2/c1-14(18-16-9-5-3-6-10-16)13-15(2)19-17-11-7-4-8-12-17/h13,16-18H,3-12H2,1-2H3/b14-13+,19-15+ |
| InChIKey | XKARPJLZOZHNMC-MNOJGGAQSA-N |
| XLogP | 4.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|