C11H18N2 — CID 102439079
(5aR,9aR)-2,4-dimethyl-5a,6,7,8,9,9a-hexahydro-1H-1,5-benzodiazepine (PubChem CID 102439079) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (5aR,9aR)-2,4-dimethyl-5a,6,7,8,9,9a-hexahydro-1H-1,5-benzodiazepine.
| Compound Name | (5aR,9aR)-2,4-dimethyl-5a,6,7,8,9,9a-hexahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 102439079 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (5aR,9aR)-2,4-dimethyl-5a,6,7,8,9,9a-hexahydro-1H-1,5-benzodiazepine |
| SMILES | CC1=CC(C)=N[C@@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C11H18N2/c1-8-7-9(2)13-11-6-4-3-5-10(11)12-8/h7,10-12H,3-6H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | WTAIWRFOCQYXSL-GHMZBOCLSA-N |
| XLogP | 2.27 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |