C12H18N2 — CID 11513902
(4aR,10aR)-1,2,3,4,4a,5,7,8,9,10a-decahydrophenazine (PubChem CID 11513902) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (4aR,10aR)-1,2,3,4,4a,5,7,8,9,10a-decahydrophenazine.
| Compound Name | (4aR,10aR)-1,2,3,4,4a,5,7,8,9,10a-decahydrophenazine |
|---|---|
| PubChem CID | 11513902 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (4aR,10aR)-1,2,3,4,4a,5,7,8,9,10a-decahydrophenazine |
| SMILES | C1=C2N[C@@H]3CCCC[C@H]3N=C2CCC1 |
| InChI | InChI=1S/C12H18N2/c1-2-6-10-9(5-1)13-11-7-3-4-8-12(11)14-10/h5,11-13H,1-4,6-8H2/t11-,12-/m1/s1 |
| InChIKey | DHECBFMIDDGLEY-VXGBXAGGSA-N |
| XLogP | 2.41 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |