C13H16N2 — CID 10867349
(4aR,11aR)-2,3,4,4a,11,11a-hexahydro-1H-cyclohepta[b]quinoxaline (PubChem CID 10867349) has the molecular formula C13H16N2 and a molecular weight of 200.29 g/mol. Its IUPAC name is (4aR,11aR)-2,3,4,4a,11,11a-hexahydro-1H-cyclohepta[b]quinoxaline.
| Compound Name | (4aR,11aR)-2,3,4,4a,11,11a-hexahydro-1H-cyclohepta[b]quinoxaline |
|---|---|
| PubChem CID | 10867349 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (4aR,11aR)-2,3,4,4a,11,11a-hexahydro-1H-cyclohepta[b]quinoxaline |
| SMILES | C1=CC=C2N[C@@H]3CCCC[C@H]3N=C2C=C1 |
| InChI | InChI=1S/C13H16N2/c1-2-6-10-11(7-3-1)15-13-9-5-4-8-12(13)14-10/h1-3,6-7,12-14H,4-5,8-9H2/t12-,13-/m1/s1 |
| InChIKey | CMXUYDNNETWVTK-CHWSQXEVSA-N |
| XLogP | 2.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'colchicine_A(3)', 'substructure': 'N/A'} |
|---|