C22H28N4 — CID 100939025
trans-(1R,2R)-1-N,2-N-bis(7-methyliminocyclohepta-1,3,5-trien-1-yl)cyclohexane-1,2-diamine (PubChem CID 100939025) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis(7-methyliminocyclohepta-1,3,5-trien-1-yl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis(7-methyliminocyclohepta-1,3,5-trien-1-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 100939025 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis(7-methyliminocyclohepta-1,3,5-trien-1-yl)cyclohexane-1,2-diamine |
| SMILES | C/N=c1\cccccc1N[C@@H]1CCCC[C@H]1Nc1ccccc/c1=N\C |
| InChI | InChI=1S/C22H28N4/c1-23-17-11-5-3-7-13-19(17)25-21-15-9-10-16-22(21)26-20-14-8-4-6-12-18(20)24-2/h3-8,11-14,21-22H,9-10,15-16H2,1-2H3,(H,23,25)(H,24,26)/t21-,22-/m1/s1 |
| InChIKey | BGIIROCYIYZFNM-FGZHOGPDSA-N |
| XLogP | 3.58 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |