C21H39N5 — CID 59529657
(1R,6R,11R,17Z,20R)-16,18-dimethyl-2,5,12,15,19-pentazatricyclo[18.4.0.06,11]tetracosa-15,17-diene (PubChem CID 59529657) has the molecular formula C21H39N5 and a molecular weight of 361.58 g/mol. Its IUPAC name is (1R,6R,11R,17Z,20R)-16,18-dimethyl-2,5,12,15,19-pentazatricyclo[18.4.0.06,11]tetracosa-15,17-diene.
| Compound Name | (1R,6R,11R,17Z,20R)-16,18-dimethyl-2,5,12,15,19-pentazatricyclo[18.4.0.06,11]tetracosa-15,17-diene |
|---|---|
| PubChem CID | 59529657 |
| Molecular Formula | C21H39N5 |
| Molecular Weight | 361.58 g/mol |
| Exact Mass | 361.32 |
| IUPAC Name | (1R,6R,11R,17Z,20R)-16,18-dimethyl-2,5,12,15,19-pentazatricyclo[18.4.0.06,11]tetracosa-15,17-diene |
| SMILES | C/C1=C/C(C)=N/CCN[C@@H]2CCCC[C@H]2NCCN[C@@H]2CCCC[C@H]2N1 |
| InChI | InChI=1S/C21H39N5/c1-16-15-17(2)26-21-10-6-5-9-20(21)25-14-13-24-19-8-4-3-7-18(19)23-12-11-22-16/h15,18-21,23-26H,3-14H2,1-2H3/b17-15-,22-16+/t18-,19-,20-,21-/m1/s1 |
| InChIKey | ABGMOYCUJUSKEZ-XBDSPYBASA-N |
| XLogP | 2.35 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |