C16H24N2 — CID 101432855
7-cyclohexylimino-N-propan-2-ylcyclohepta-1,3,5-trien-1-amine (PubChem CID 101432855) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 7-cyclohexylimino-N-propan-2-ylcyclohepta-1,3,5-trien-1-amine.
| Compound Name | 7-cyclohexylimino-N-propan-2-ylcyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 101432855 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 7-cyclohexylimino-N-propan-2-ylcyclohepta-1,3,5-trien-1-amine |
| SMILES | CC(C)Nc1ccccc/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C16H24N2/c1-13(2)17-15-11-7-4-8-12-16(15)18-14-9-5-3-6-10-14/h4,7-8,11-14H,3,5-6,9-10H2,1-2H3,(H,17,18) |
| InChIKey | IKYSBUWGWCLMNT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |