C15H30N4 — CID 142907376
(E,6E)-6-(2-aminopropan-2-ylimino)-4-N-cyclohexylhex-4-ene-1,4-diamine (PubChem CID 142907376) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is (E,6E)-6-(2-aminopropan-2-ylimino)-4-N-cyclohexylhex-4-ene-1,4-diamine.
| Compound Name | (E,6E)-6-(2-aminopropan-2-ylimino)-4-N-cyclohexylhex-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 142907376 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | (E,6E)-6-(2-aminopropan-2-ylimino)-4-N-cyclohexylhex-4-ene-1,4-diamine |
| SMILES | CC(C)(N)/N=C/C=C(\CCCN)NC1CCCCC1 |
| InChI | InChI=1S/C15H30N4/c1-15(2,17)18-12-10-14(9-6-11-16)19-13-7-4-3-5-8-13/h10,12-13,19H,3-9,11,16-17H2,1-2H3/b14-10+,18-12+ |
| InChIKey | UMHKYYSZJFJPOF-OSUGJSQMSA-N |
| XLogP | 2.30 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|