C17H34N4O2 — CID 119569667
N-[3-(aminomethyl)pentan-3-yl]-4-(cyclohexylcarbamoylamino)butanamide (PubChem CID 119569667) has the molecular formula C17H34N4O2 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-4-(cyclohexylcarbamoylamino)butanamide.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-4-(cyclohexylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 119569667 |
| Molecular Formula | C17H34N4O2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-4-(cyclohexylcarbamoylamino)butanamide |
| SMILES | CCC(CC)(CN)NC(=O)CCCNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H34N4O2/c1-3-17(4-2,13-18)21-15(22)11-8-12-19-16(23)20-14-9-6-5-7-10-14/h14H,3-13,18H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | YJQWEXMHRZXORV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|