C17H32N2 — CID 12065549
N-[(E)-1-tert-butyliminohept-2-en-3-yl]cyclohexanamine (PubChem CID 12065549) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N-[(E)-1-tert-butyliminohept-2-en-3-yl]cyclohexanamine.
| Compound Name | N-[(E)-1-tert-butyliminohept-2-en-3-yl]cyclohexanamine |
|---|---|
| PubChem CID | 12065549 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-[(E)-1-tert-butyliminohept-2-en-3-yl]cyclohexanamine |
| SMILES | CCCC/C(=C\C=N\C(C)(C)C)NC1CCCCC1 |
| InChI | InChI=1S/C17H32N2/c1-5-6-10-16(13-14-18-17(2,3)4)19-15-11-8-7-9-12-15/h13-15,19H,5-12H2,1-4H3/b16-13+,18-14+ |
| InChIKey | ONMVLAZXIPPHMX-KSQUNMIPSA-N |
| XLogP | 4.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|