C16H32N2 — CID 142806830
(Z)-7-butan-2-ylimino-N-propylhept-2-en-3-amine;ethene (PubChem CID 142806830) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is (Z)-7-butan-2-ylimino-N-propylhept-2-en-3-amine;ethene.
| Compound Name | (Z)-7-butan-2-ylimino-N-propylhept-2-en-3-amine;ethene |
|---|---|
| PubChem CID | 142806830 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | (Z)-7-butan-2-ylimino-N-propylhept-2-en-3-amine;ethene |
| SMILES | C/C=C(/CCC/C=N/C(C)CC)NCCC.C=C |
| InChI | InChI=1S/C14H28N2.C2H4/c1-5-11-16-14(7-3)10-8-9-12-15-13(4)6-2;1-2/h7,12-13,16H,5-6,8-11H2,1-4H3;1-2H2/b14-7-,15-12+; |
| InChIKey | VOHSWRVQMXILQZ-YABIWUOQSA-N |
| XLogP | 4.73 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|