C17H33N3 — CID 91369631
N'-(cyclohexen-1-yl)-N-[3-(2,2-dimethylpropylideneamino)propyl]propane-1,3-diamine (PubChem CID 91369631) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is N'-(cyclohexen-1-yl)-N-[3-(2,2-dimethylpropylideneamino)propyl]propane-1,3-diamine.
| Compound Name | N'-(cyclohexen-1-yl)-N-[3-(2,2-dimethylpropylideneamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 91369631 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | N'-(cyclohexen-1-yl)-N-[3-(2,2-dimethylpropylideneamino)propyl]propane-1,3-diamine |
| SMILES | CC(C)(C)/C=N/CCCNCCCNC1=CCCCC1 |
| InChI | InChI=1S/C17H33N3/c1-17(2,3)15-19-13-7-11-18-12-8-14-20-16-9-5-4-6-10-16/h9,15,18,20H,4-8,10-14H2,1-3H3/b19-15+ |
| InChIKey | DSKDRYICSPRUFH-XDJHFCHBSA-N |
| XLogP | 3.52 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|