C17H32N2 — CID 135002744
N-[(Z)-4-(tert-butyliminomethyl)hex-3-en-3-yl]cyclohexanamine (PubChem CID 135002744) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is N-[(Z)-4-(tert-butyliminomethyl)hex-3-en-3-yl]cyclohexanamine.
| Compound Name | N-[(Z)-4-(tert-butyliminomethyl)hex-3-en-3-yl]cyclohexanamine |
|---|---|
| PubChem CID | 135002744 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-[(Z)-4-(tert-butyliminomethyl)hex-3-en-3-yl]cyclohexanamine |
| SMILES | CCC(/C=N/C(C)(C)C)=C(\CC)NC1CCCCC1 |
| InChI | InChI=1S/C17H32N2/c1-6-14(13-18-17(3,4)5)16(7-2)19-15-11-9-8-10-12-15/h13,15,19H,6-12H2,1-5H3/b16-14-,18-13+ |
| InChIKey | KYNAOGZTWKKFHY-XORKRYJBSA-N |
| XLogP | 4.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|