C13H8Cl2OP- — CID 21343849
(2,6-dichlorophenyl)-phenylphosphanylidenemethanolate (PubChem CID 21343849) has the molecular formula C13H8Cl2OP- and a molecular weight of 282.09 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-phenylphosphanylidenemethanolate.
| Compound Name | (2,6-dichlorophenyl)-phenylphosphanylidenemethanolate |
|---|---|
| PubChem CID | 21343849 |
| Molecular Formula | C13H8Cl2OP- |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.97 |
| IUPAC Name | (2,6-dichlorophenyl)-phenylphosphanylidenemethanolate |
| SMILES | [O-]/C(=P\c1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H9Cl2OP/c14-10-7-4-8-11(15)12(10)13(16)17-9-5-2-1-3-6-9/h1-8,16H/p-1 |
| InChIKey | OIIKITGSSAMHSB-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|