About CID 21344076
CID 21344076 (PubChem CID 21344076) has the molecular formula C4H7BOS
and a molecular weight of 113.98 g/mol.
Molecular Properties
| Compound Name | CID 21344076 |
| PubChem CID | 21344076 |
| Molecular Formula | C4H7BOS |
| Molecular Weight | 113.98 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | — |
| SMILES | [B]/C=C/C(O)SC |
| InChI | InChI=1S/C4H7BOS/c1-7-4(6)2-3-5/h2-4,6H,1H3/b3-2+ |
| InChIKey | HZYZJMKLENSARJ-NSCUHMNNSA-N |
| XLogP | 0.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.98 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 21344076 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21344076?
The IUPAC name of CID 21344076 (CID 21344076) is not available.
What is the SMILES notation for CID 21344076?
The canonical SMILES for CID 21344076 is [B]/C=C/C(O)SC.
What is the InChIKey of CID 21344076?
The InChIKey is HZYZJMKLENSARJ-NSCUHMNNSA-N. The full InChI is InChI=1S/C4H7BOS/c1-7-4(6)2-3-5/h2-4,6H,1H3/b3-2+.
What are the key properties of CID 21344076?
CID 21344076 has a molecular weight of 113.98 g/mol, XLogP of 0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21344076 is sourced from PubChem (CID 21344076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).