About 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene
2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene (PubChem CID 21344469) has the molecular formula C19H22
and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene |
| PubChem CID | 21344469 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene |
| SMILES | C=Cc1ccc(CCc2c(C)cc(C)cc2C)cc1 |
| InChI | InChI=1S/C19H22/c1-5-17-6-8-18(9-7-17)10-11-19-15(3)12-14(2)13-16(19)4/h5-9,12-13H,1,10-11H2,2-4H3 |
| InChIKey | BRVLTRSWFIPEHS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene?
The IUPAC name of 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene (CID 21344469) is 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene?
The canonical SMILES for 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene is C=Cc1ccc(CCc2c(C)cc(C)cc2C)cc1.
What is the InChIKey of 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene?
The InChIKey is BRVLTRSWFIPEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22/c1-5-17-6-8-18(9-7-17)10-11-19-15(3)12-14(2)13-16(19)4/h5-9,12-13H,1,10-11H2,2-4H3.
What are the key properties of 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene?
2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene has a molecular weight of 250.38 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-ethenylphenyl)ethyl]-1,3,5-trimethylbenzene is sourced from PubChem (CID 21344469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).