C24H21NO5S — CID 2134451
N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)sulfonylchromen-2-imine (PubChem CID 2134451) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)sulfonylchromen-2-imine.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)sulfonylchromen-2-imine |
|---|---|
| PubChem CID | 2134451 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-(4-methylphenyl)sulfonylchromen-2-imine |
| SMILES | COc1ccc(/N=c2\oc3ccccc3cc2S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C24H21NO5S/c1-16-8-11-19(12-9-16)31(26,27)23-14-17-6-4-5-7-20(17)30-24(23)25-18-10-13-21(28-2)22(15-18)29-3/h4-15H,1-3H3/b25-24- |
| InChIKey | ZMHQKFYOJJWQMP-IZHYLOQSSA-N |
| XLogP | 4.82 |
| TPSA | 78.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |