C10H18O2 — CID 21344808
1-ethylidene-3,5-dimethoxycyclohexane (PubChem CID 21344808) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 1-ethylidene-3,5-dimethoxycyclohexane.
| Compound Name | 1-ethylidene-3,5-dimethoxycyclohexane |
|---|---|
| PubChem CID | 21344808 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 1-ethylidene-3,5-dimethoxycyclohexane |
| SMILES | CC=C1CC(OC)CC(OC)C1 |
| InChI | InChI=1S/C10H18O2/c1-4-8-5-9(11-2)7-10(6-8)12-3/h4,9-10H,5-7H2,1-3H3 |
| InChIKey | YGVNVEVWTOOJEV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|