C14H17FN2O2 — CID 21345151
3-[(3-fluorophenyl)methoxy]-N-prop-2-enylazetidine-1-carboxamide (PubChem CID 21345151) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methoxy]-N-prop-2-enylazetidine-1-carboxamide.
| Compound Name | 3-[(3-fluorophenyl)methoxy]-N-prop-2-enylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 21345151 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[(3-fluorophenyl)methoxy]-N-prop-2-enylazetidine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CC(OCc2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H17FN2O2/c1-2-6-16-14(18)17-8-13(9-17)19-10-11-4-3-5-12(15)7-11/h2-5,7,13H,1,6,8-10H2,(H,16,18) |
| InChIKey | SNWKOBNROOHCDY-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|