C20H22N6O2 — CID 2134777
5-amino-N-(2-ethylphenyl)-1-[2-(2-methylanilino)-2-oxoethyl]triazole-4-carboxamide (PubChem CID 2134777) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 5-amino-N-(2-ethylphenyl)-1-[2-(2-methylanilino)-2-oxoethyl]triazole-4-carboxamide.
| Compound Name | 5-amino-N-(2-ethylphenyl)-1-[2-(2-methylanilino)-2-oxoethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 2134777 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 5-amino-N-(2-ethylphenyl)-1-[2-(2-methylanilino)-2-oxoethyl]triazole-4-carboxamide |
| SMILES | CCc1ccccc1NC(=O)c1nnn(CC(=O)Nc2ccccc2C)c1N |
| InChI | InChI=1S/C20H22N6O2/c1-3-14-9-5-7-11-16(14)23-20(28)18-19(21)26(25-24-18)12-17(27)22-15-10-6-4-8-13(15)2/h4-11H,3,12,21H2,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | MKHOUHLOUNWLRM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |