C17H24N2O4 — CID 21348032
N,3-dihydroxy-2-[3-methyl-3-[2-(3-methylphenyl)ethyl]-2-oxopyrrolidin-1-yl]propanamide (PubChem CID 21348032) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N,3-dihydroxy-2-[3-methyl-3-[2-(3-methylphenyl)ethyl]-2-oxopyrrolidin-1-yl]propanamide.
| Compound Name | N,3-dihydroxy-2-[3-methyl-3-[2-(3-methylphenyl)ethyl]-2-oxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 21348032 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N,3-dihydroxy-2-[3-methyl-3-[2-(3-methylphenyl)ethyl]-2-oxopyrrolidin-1-yl]propanamide |
| SMILES | Cc1cccc(CCC2(C)CCN(C(CO)C(=O)NO)C2=O)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-12-4-3-5-13(10-12)6-7-17(2)8-9-19(16(17)22)14(11-20)15(21)18-23/h3-5,10,14,20,23H,6-9,11H2,1-2H3,(H,18,21) |
| InChIKey | JCODJHWYTNBOLL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|