C13H18O — CID 79332898
2-methyl-1-[2-(3-methylphenyl)ethyl]cyclopropan-1-ol (PubChem CID 79332898) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methylphenyl)ethyl]cyclopropan-1-ol.
| Compound Name | 2-methyl-1-[2-(3-methylphenyl)ethyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 79332898 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-methyl-1-[2-(3-methylphenyl)ethyl]cyclopropan-1-ol |
| SMILES | Cc1cccc(CCC2(O)CC2C)c1 |
| InChI | InChI=1S/C13H18O/c1-10-4-3-5-12(8-10)6-7-13(14)9-11(13)2/h3-5,8,11,14H,6-7,9H2,1-2H3 |
| InChIKey | JQUWFOIRACRSGV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |