C19H31N3O — CID 108900751
1-[2-(3-methylphenyl)ethyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea (PubChem CID 108900751) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-[2-(3-methylphenyl)ethyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea.
| Compound Name | 1-[2-(3-methylphenyl)ethyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 108900751 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | 1-[2-(3-methylphenyl)ethyl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea |
| SMILES | Cc1cccc(CCNC(=O)NC2CC(C)(C)NC(C)(C)C2)c1 |
| InChI | InChI=1S/C19H31N3O/c1-14-7-6-8-15(11-14)9-10-20-17(23)21-16-12-18(2,3)22-19(4,5)13-16/h6-8,11,16,22H,9-10,12-13H2,1-5H3,(H2,20,21,23) |
| InChIKey | BOMKAYFJZFJUBO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |